About 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide
4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide (PubChem CID 107104246) has the molecular formula C9H12BrN3O3
and a molecular weight of 290.12 g/mol. Its IUPAC name is 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide |
| PubChem CID | 107104246 |
| Molecular Formula | C9H12BrN3O3 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1c(=O)[nH]cc(Br)c1=O |
| InChI | InChI=1S/C9H12BrN3O3/c1-11-7(14)3-2-4-13-8(15)6(10)5-12-9(13)16/h5H,2-4H2,1H3,(H,11,14)(H,12,16) |
| InChIKey | MJNDQHDCCPMRGO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide?
The IUPAC name of 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide (CID 107104246) is 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide.
What is the SMILES notation for 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide?
The canonical SMILES for 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide is CNC(=O)CCCn1c(=O)[nH]cc(Br)c1=O.
What is the InChIKey of 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide?
The InChIKey is MJNDQHDCCPMRGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN3O3/c1-11-7(14)3-2-4-13-8(15)6(10)5-12-9(13)16/h5H,2-4H2,1H3,(H,11,14)(H,12,16).
What are the key properties of 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide?
4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide has a molecular weight of 290.12 g/mol, XLogP of -0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-methylbutanamide is sourced from PubChem (CID 107104246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).