C12H13F3N2O2 — CID 107104728
2-(2-methoxyethylamino)-2-[3-(trifluoromethoxy)phenyl]acetonitrile (PubChem CID 107104728) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-2-[3-(trifluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-(2-methoxyethylamino)-2-[3-(trifluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 107104728 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-2-[3-(trifluoromethoxy)phenyl]acetonitrile |
| SMILES | COCCNC(C#N)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-18-6-5-17-11(8-16)9-3-2-4-10(7-9)19-12(13,14)15/h2-4,7,11,17H,5-6H2,1H3 |
| InChIKey | KLEIJJBHORIYRJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|