C17H20O4Si — CID 10710530
(1R,5S,7S)-7-ethenyl-1-phenyl-7-trimethylsilyloxy-2-oxabicyclo[3.2.0]heptane-3,4-dione (PubChem CID 10710530) has the molecular formula C17H20O4Si and a molecular weight of 316.43 g/mol. Its IUPAC name is (1R,5S,7S)-7-ethenyl-1-phenyl-7-trimethylsilyloxy-2-oxabicyclo[3.2.0]heptane-3,4-dione.
| Compound Name | (1R,5S,7S)-7-ethenyl-1-phenyl-7-trimethylsilyloxy-2-oxabicyclo[3.2.0]heptane-3,4-dione |
|---|---|
| PubChem CID | 10710530 |
| Molecular Formula | C17H20O4Si |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (1R,5S,7S)-7-ethenyl-1-phenyl-7-trimethylsilyloxy-2-oxabicyclo[3.2.0]heptane-3,4-dione |
| SMILES | C=C[C@@]1(O[Si](C)(C)C)C[C@@H]2C(=O)C(=O)O[C@@]21c1ccccc1 |
| InChI | InChI=1S/C17H20O4Si/c1-5-16(21-22(2,3)4)11-13-14(18)15(19)20-17(13,16)12-9-7-6-8-10-12/h5-10,13H,1,11H2,2-4H3/t13-,16-,17+/m1/s1 |
| InChIKey | ZJRWJFUBOMJHHL-XYPHTWIQSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|