About 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal
4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal (PubChem CID 10710616) has the molecular formula C17H23NO3Si
and a molecular weight of 317.46 g/mol. Its IUPAC name is 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal.
Molecular Properties
| Compound Name | 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal |
| PubChem CID | 10710616 |
| Molecular Formula | C17H23NO3Si |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@@H](CC#CC=O)[C@@H]1CC#CC=O |
| InChI | InChI=1S/C17H23NO3Si/c1-17(2,3)22(4,5)18-15(11-7-9-13-20)14(16(18)21)10-6-8-12-19/h12-15H,10-11H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | OVELVAQERAPHCT-GJZGRUSLSA-N |
| XLogP | 2.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal?
The IUPAC name of 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal (CID 10710616) is 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal.
What is the SMILES notation for 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal?
The canonical SMILES for 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal is CC(C)(C)[Si](C)(C)N1C(=O)[C@@H](CC#CC=O)[C@@H]1CC#CC=O.
What is the InChIKey of 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal?
The InChIKey is OVELVAQERAPHCT-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H23NO3Si/c1-17(2,3)22(4,5)18-15(11-7-9-13-20)14(16(18)21)10-6-8-12-19/h12-15H,10-11H2,1-5H3/t14-,15-/m0/s1.
What are the key properties of 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal?
4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal has a molecular weight of 317.46 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4S)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(4-oxobut-2-ynyl)azetidin-3-yl]but-2-ynal is sourced from PubChem (CID 10710616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).