C12H14N2 — CID 107106808
2-(cyclobutylamino)-3-methylbenzonitrile (PubChem CID 107106808) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(cyclobutylamino)-3-methylbenzonitrile.
| Compound Name | 2-(cyclobutylamino)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 107106808 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-(cyclobutylamino)-3-methylbenzonitrile |
| SMILES | Cc1cccc(C#N)c1NC1CCC1 |
| InChI | InChI=1S/C12H14N2/c1-9-4-2-5-10(8-13)12(9)14-11-6-3-7-11/h2,4-5,11,14H,3,6-7H2,1H3 |
| InChIKey | WQABUMGSHATIMV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |