C18H25NO4 — CID 10710761
tert-butyl (3S,4R)-3-hydroxy-4-phenylmethoxy-2,3,4,7-tetrahydroazepine-1-carboxylate (PubChem CID 10710761) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-hydroxy-4-phenylmethoxy-2,3,4,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-hydroxy-4-phenylmethoxy-2,3,4,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 10710761 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl (3S,4R)-3-hydroxy-4-phenylmethoxy-2,3,4,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C[C@@H](OCc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2,3)23-17(21)19-11-7-10-16(15(20)12-19)22-13-14-8-5-4-6-9-14/h4-10,15-16,20H,11-13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | QBFORTSUNHGSGW-JKSUJKDBSA-N |
| XLogP | 2.74 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|