C12H16N2S2 — CID 107108661
3-methyl-2-(thiolan-3-ylamino)benzenecarbothioamide (PubChem CID 107108661) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 3-methyl-2-(thiolan-3-ylamino)benzenecarbothioamide.
| Compound Name | 3-methyl-2-(thiolan-3-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107108661 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-methyl-2-(thiolan-3-ylamino)benzenecarbothioamide |
| SMILES | Cc1cccc(C(N)=S)c1NC1CCSC1 |
| InChI | InChI=1S/C12H16N2S2/c1-8-3-2-4-10(12(13)15)11(8)14-9-5-6-16-7-9/h2-4,9,14H,5-7H2,1H3,(H2,13,15) |
| InChIKey | IZIUMPODQGLETK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|