C19H32O2Si — CID 10710867
(Z,3S,5S,8S)-8-[dimethyl(phenyl)silyl]-2,2-dimethylnon-6-ene-3,5-diol (PubChem CID 10710867) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (Z,3S,5S,8S)-8-[dimethyl(phenyl)silyl]-2,2-dimethylnon-6-ene-3,5-diol.
| Compound Name | (Z,3S,5S,8S)-8-[dimethyl(phenyl)silyl]-2,2-dimethylnon-6-ene-3,5-diol |
|---|---|
| PubChem CID | 10710867 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (Z,3S,5S,8S)-8-[dimethyl(phenyl)silyl]-2,2-dimethylnon-6-ene-3,5-diol |
| SMILES | C[C@@H](/C=C\[C@@H](O)C[C@H](O)C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H32O2Si/c1-15(22(5,6)17-10-8-7-9-11-17)12-13-16(20)14-18(21)19(2,3)4/h7-13,15-16,18,20-21H,14H2,1-6H3/b13-12-/t15-,16+,18-/m0/s1 |
| InChIKey | YSJLTRDKDOYNEZ-KQGPQTFTSA-N |
| XLogP | 3.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|