C18H25NOS — CID 107108954
3-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]benzenecarbothioamide (PubChem CID 107108954) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 3-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]benzenecarbothioamide.
| Compound Name | 3-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 107108954 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]benzenecarbothioamide |
| SMILES | Cc1cccc(C(N)=S)c1OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C18H25NOS/c1-11-6-5-7-13(16(19)21)15(11)20-14-10-12-8-9-18(14,4)17(12,2)3/h5-7,12,14H,8-10H2,1-4H3,(H2,19,21) |
| InChIKey | GJACZICYQDJSIM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|