C12H19N3O — CID 107109142
N'-hydroxy-3-methyl-2-[methyl(propyl)amino]benzenecarboximidamide (PubChem CID 107109142) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N'-hydroxy-3-methyl-2-[methyl(propyl)amino]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-methyl-2-[methyl(propyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107109142 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N'-hydroxy-3-methyl-2-[methyl(propyl)amino]benzenecarboximidamide |
| SMILES | CCCN(C)c1c(C)cccc1/C(N)=N/O |
| InChI | InChI=1S/C12H19N3O/c1-4-8-15(3)11-9(2)6-5-7-10(11)12(13)14-16/h5-7,16H,4,8H2,1-3H3,(H2,13,14) |
| InChIKey | FMEUJSMRKXCWIZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|