About 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine
2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine (PubChem CID 10710946) has the molecular formula C16H13F3N2O2
and a molecular weight of 322.29 g/mol. Its IUPAC name is 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine |
| PubChem CID | 10710946 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine |
| SMILES | CC1(C)N=C(c2ccccn2)c2cc(OC(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-15(2)21-14(12-5-3-4-8-20-12)11-9-10(22-16(17,18)19)6-7-13(11)23-15/h3-9H,1-2H3 |
| InChIKey | AKRHGXJMDOFCOM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine?
The IUPAC name of 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine (CID 10710946) is 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine.
What is the SMILES notation for 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine?
The canonical SMILES for 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine is CC1(C)N=C(c2ccccn2)c2cc(OC(F)(F)F)ccc2O1.
What is the InChIKey of 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine?
The InChIKey is AKRHGXJMDOFCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2O2/c1-15(2)21-14(12-5-3-4-8-20-12)11-9-10(22-16(17,18)19)6-7-13(11)23-15/h3-9H,1-2H3.
What are the key properties of 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine?
2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine has a molecular weight of 322.29 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-pyridin-2-yl-6-(trifluoromethoxy)-1,3-benzoxazine is sourced from PubChem (CID 10710946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).