C13H21F3N4O — CID 107109658
1-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]pyrazol-3-amine (PubChem CID 107109658) has the molecular formula C13H21F3N4O and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]pyrazol-3-amine.
| Compound Name | 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 107109658 |
| Molecular Formula | C13H21F3N4O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-4-yl]pyrazol-3-amine |
| SMILES | Nc1ccn(C2CCN(CCCOCC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C13H21F3N4O/c14-13(15,16)10-21-9-1-5-19-6-2-11(3-7-19)20-8-4-12(17)18-20/h4,8,11H,1-3,5-7,9-10H2,(H2,17,18) |
| InChIKey | CZUGNUACJIONEG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|