C13H22N6O — CID 107109700
1-[2-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]ethyl]imidazolidin-2-one (PubChem CID 107109700) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-[2-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 107109700 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-[2-[4-(3-aminopyrazol-1-yl)piperidin-1-yl]ethyl]imidazolidin-2-one |
| SMILES | Nc1ccn(C2CCN(CCN3CCNC3=O)CC2)n1 |
| InChI | InChI=1S/C13H22N6O/c14-12-3-7-19(16-12)11-1-5-17(6-2-11)9-10-18-8-4-15-13(18)20/h3,7,11H,1-2,4-6,8-10H2,(H2,14,16)(H,15,20) |
| InChIKey | FGDQGJTVHGZIHZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |