C12H19F3N4O — CID 107109720
1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-4-yl]pyrazol-3-amine (PubChem CID 107109720) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-4-yl]pyrazol-3-amine.
| Compound Name | 1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-4-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 107109720 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-4-yl]pyrazol-3-amine |
| SMILES | Nc1ccn(C2CCN(CCOCC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C12H19F3N4O/c13-12(14,15)9-20-8-7-18-4-1-10(2-5-18)19-6-3-11(16)17-19/h3,6,10H,1-2,4-5,7-9H2,(H2,16,17) |
| InChIKey | WWHLASUIQDZTQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|