C15H24N6 — CID 107109996
1-[1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-yl]pyrazol-3-amine (PubChem CID 107109996) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 1-[1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-yl]pyrazol-3-amine.
| Compound Name | 1-[1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 107109996 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-[1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-yl]pyrazol-3-amine |
| SMILES | CCn1nc(C)cc1CN1CCC(n2ccc(N)n2)CC1 |
| InChI | InChI=1S/C15H24N6/c1-3-20-14(10-12(2)17-20)11-19-7-4-13(5-8-19)21-9-6-15(16)18-21/h6,9-10,13H,3-5,7-8,11H2,1-2H3,(H2,16,18) |
| InChIKey | VZPKKTMHFBIZQK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |