C19H36O2Si — CID 10711140
(2Z,8E,10E)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-ol (PubChem CID 10711140) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is (2Z,8E,10E)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-ol.
| Compound Name | (2Z,8E,10E)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-ol |
|---|---|
| PubChem CID | 10711140 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (2Z,8E,10E)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-ol |
| SMILES | C/C=C/C=C/CC(C)CC(O)/C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-8-9-10-11-13-17(2)16-18(20)14-12-15-21-22(6,7)19(3,4)5/h8-12,14,17-18,20H,13,15-16H2,1-7H3/b9-8+,11-10+,14-12- |
| InChIKey | YCJTVCUCXCSFOY-UGQUYLDXSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|