About 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone
1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone (PubChem CID 10711157) has the molecular formula C12H22O3SSe
and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone.
Molecular Properties
| Compound Name | 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone |
| PubChem CID | 10711157 |
| Molecular Formula | C12H22O3SSe |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone |
| SMILES | CCCCSC(=[Se])CC(O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O3SSe/c1-4-5-6-16-11(17)7-9(13)10-8-14-12(2,3)15-10/h9-10,13H,4-8H2,1-3H3/t9?,10-/m1/s1 |
| InChIKey | SMPMENUISGMQGV-QVDQXJPCSA-N |
| XLogP | 1.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone?
The IUPAC name of 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone (CID 10711157) is 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone.
What is the SMILES notation for 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone?
The canonical SMILES for 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone is CCCCSC(=[Se])CC(O)[C@H]1COC(C)(C)O1.
What is the InChIKey of 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone?
The InChIKey is SMPMENUISGMQGV-QVDQXJPCSA-N. The full InChI is InChI=1S/C12H22O3SSe/c1-4-5-6-16-11(17)7-9(13)10-8-14-12(2,3)15-10/h9-10,13H,4-8H2,1-3H3/t9?,10-/m1/s1.
What are the key properties of 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone?
1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone has a molecular weight of 325.33 g/mol, XLogP of 1.72, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxypropane-1-selone is sourced from PubChem (CID 10711157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).