C17H27NO3S — CID 10711190
2-[(2R,4R,5S,6S)-5-butoxy-4-methoxy-4,6-dimethyloxan-2-yl]sulfanylpyridine (PubChem CID 10711190) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-[(2R,4R,5S,6S)-5-butoxy-4-methoxy-4,6-dimethyloxan-2-yl]sulfanylpyridine.
| Compound Name | 2-[(2R,4R,5S,6S)-5-butoxy-4-methoxy-4,6-dimethyloxan-2-yl]sulfanylpyridine |
|---|---|
| PubChem CID | 10711190 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[(2R,4R,5S,6S)-5-butoxy-4-methoxy-4,6-dimethyloxan-2-yl]sulfanylpyridine |
| SMILES | CCCCO[C@H]1[C@H](C)O[C@H](Sc2ccccn2)C[C@@]1(C)OC |
| InChI | InChI=1S/C17H27NO3S/c1-5-6-11-20-16-13(2)21-15(12-17(16,3)19-4)22-14-9-7-8-10-18-14/h7-10,13,15-16H,5-6,11-12H2,1-4H3/t13-,15+,16-,17+/m0/s1 |
| InChIKey | XXFPHFDUVYLPIK-PQEBFOHHSA-N |
| XLogP | 3.90 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|