About 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea
1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 10711230) has the molecular formula C16H14N4O2S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea |
| PubChem CID | 10711230 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C16H14N4O2S/c1-22-13-10-6-5-9-12(13)17-15(21)19-16-18-14(20-23-16)11-7-3-2-4-8-11/h2-10H,1H3,(H2,17,18,19,20,21) |
| InChIKey | OQQPLVWSKSEXGZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea?
The IUPAC name of 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea (CID 10711230) is 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea.
What is the SMILES notation for 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea?
The canonical SMILES for 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea is COc1ccccc1NC(=O)Nc1nc(-c2ccccc2)ns1.
What is the InChIKey of 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea?
The InChIKey is OQQPLVWSKSEXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O2S/c1-22-13-10-6-5-9-12(13)17-15(21)19-16-18-14(20-23-16)11-7-3-2-4-8-11/h2-10H,1H3,(H2,17,18,19,20,21).
What are the key properties of 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea?
1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea has a molecular weight of 326.38 g/mol, XLogP of 3.86, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyphenyl)-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea is sourced from PubChem (CID 10711230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).