C16H22N2O2S — CID 107112953
3-amino-N-(3-hydroxypropyl)-7-methyl-N-propan-2-yl-1-benzothiophene-2-carboxamide (PubChem CID 107112953) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-amino-N-(3-hydroxypropyl)-7-methyl-N-propan-2-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-(3-hydroxypropyl)-7-methyl-N-propan-2-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107112953 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-amino-N-(3-hydroxypropyl)-7-methyl-N-propan-2-yl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cccc2c(N)c(C(=O)N(CCCO)C(C)C)sc12 |
| InChI | InChI=1S/C16H22N2O2S/c1-10(2)18(8-5-9-19)16(20)15-13(17)12-7-4-6-11(3)14(12)21-15/h4,6-7,10,19H,5,8-9,17H2,1-3H3 |
| InChIKey | NAOCXVNALZXJIO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |