C16H33NO2Si2 — CID 10711323
(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[ethenyl(dimethyl)silyl]methyl]azetidin-2-one (PubChem CID 10711323) has the molecular formula C16H33NO2Si2 and a molecular weight of 327.62 g/mol. Its IUPAC name is (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[ethenyl(dimethyl)silyl]methyl]azetidin-2-one.
| Compound Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[ethenyl(dimethyl)silyl]methyl]azetidin-2-one |
|---|---|
| PubChem CID | 10711323 |
| Molecular Formula | C16H33NO2Si2 |
| Molecular Weight | 327.62 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[ethenyl(dimethyl)silyl]methyl]azetidin-2-one |
| SMILES | C=C[Si](C)(C)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO2Si2/c1-10-20(6,7)11-13-14(15(18)17-13)12(2)19-21(8,9)16(3,4)5/h10,12-14H,1,11H2,2-9H3,(H,17,18)/t12-,13-,14-/m1/s1 |
| InChIKey | RCAAEIVRTHWQAR-MGPQQGTHSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|