About 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole
4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole (PubChem CID 10711377) has the molecular formula C19H24N2O3
and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole |
| PubChem CID | 10711377 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole |
| SMILES | CCCOc1ccc2[nH]c3cnc(OCCC)c(COC)c3c2c1 |
| InChI | InChI=1S/C19H24N2O3/c1-4-8-23-13-6-7-16-14(10-13)18-15(12-22-3)19(24-9-5-2)20-11-17(18)21-16/h6-7,10-11,21H,4-5,8-9,12H2,1-3H3 |
| InChIKey | BTCRVOSPHNKQGJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole?
The IUPAC name of 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole (CID 10711377) is 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole?
The canonical SMILES for 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole is CCCOc1ccc2[nH]c3cnc(OCCC)c(COC)c3c2c1.
What is the InChIKey of 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole?
The InChIKey is BTCRVOSPHNKQGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3/c1-4-8-23-13-6-7-16-14(10-13)18-15(12-22-3)19(24-9-5-2)20-11-17(18)21-16/h6-7,10-11,21H,4-5,8-9,12H2,1-3H3.
What are the key properties of 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole?
4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole has a molecular weight of 328.41 g/mol, XLogP of 4.44, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-3,6-dipropoxy-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 10711377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).