C12H13ClFN3 — CID 107113900
[3-[(4-chloro-3-methylpyrazol-1-yl)methyl]-2-fluorophenyl]methanamine (PubChem CID 107113900) has the molecular formula C12H13ClFN3 and a molecular weight of 253.71 g/mol. Its IUPAC name is [3-[(4-chloro-3-methylpyrazol-1-yl)methyl]-2-fluorophenyl]methanamine.
| Compound Name | [3-[(4-chloro-3-methylpyrazol-1-yl)methyl]-2-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 107113900 |
| Molecular Formula | C12H13ClFN3 |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | [3-[(4-chloro-3-methylpyrazol-1-yl)methyl]-2-fluorophenyl]methanamine |
| SMILES | Cc1nn(Cc2cccc(CN)c2F)cc1Cl |
| InChI | InChI=1S/C12H13ClFN3/c1-8-11(13)7-17(16-8)6-10-4-2-3-9(5-15)12(10)14/h2-4,7H,5-6,15H2,1H3 |
| InChIKey | AHAZKKNKNQKLJT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |