About 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole
5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole (PubChem CID 10711404) has the molecular formula C19H18ClFN2
and a molecular weight of 328.82 g/mol. Its IUPAC name is 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole.
Molecular Properties
| Compound Name | 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole |
| PubChem CID | 10711404 |
| Molecular Formula | C19H18ClFN2 |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole |
| SMILES | F[C@@H]1CCNC[C@H]1c1c(-c2ccccc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H18ClFN2/c20-13-6-7-17-14(10-13)18(15-11-22-9-8-16(15)21)19(23-17)12-4-2-1-3-5-12/h1-7,10,15-16,22-23H,8-9,11H2/t15-,16-/m1/s1 |
| InChIKey | PAVYFSUMGRBRPZ-HZPDHXFCSA-N |
| XLogP | 4.90 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
The IUPAC name of 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole (CID 10711404) is 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole.
What is the SMILES notation for 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
The canonical SMILES for 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole is F[C@@H]1CCNC[C@H]1c1c(-c2ccccc2)[nH]c2ccc(Cl)cc12.
What is the InChIKey of 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
The InChIKey is PAVYFSUMGRBRPZ-HZPDHXFCSA-N. The full InChI is InChI=1S/C19H18ClFN2/c20-13-6-7-17-14(10-13)18(15-11-22-9-8-16(15)21)19(23-17)12-4-2-1-3-5-12/h1-7,10,15-16,22-23H,8-9,11H2/t15-,16-/m1/s1.
What are the key properties of 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole?
5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole has a molecular weight of 328.82 g/mol, XLogP of 4.90, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[(3R,4R)-4-fluoropiperidin-3-yl]-2-phenyl-1H-indole is sourced from PubChem (CID 10711404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).