C14H19IO — CID 10711463
3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol (PubChem CID 10711463) has the molecular formula C14H19IO and a molecular weight of 330.21 g/mol. Its IUPAC name is 3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol.
| Compound Name | 3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 10711463 |
| Molecular Formula | C14H19IO |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-iodo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(I)c(O)cc21 |
| InChI | InChI=1S/C14H19IO/c1-13(2)5-6-14(3,4)10-8-12(16)11(15)7-9(10)13/h7-8,16H,5-6H2,1-4H3 |
| InChIKey | SHQSYEQSIDIIBL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|