C13H16FNOS — CID 107115985
3-(cyclopentyloxymethyl)-2-fluorobenzenecarbothioamide (PubChem CID 107115985) has the molecular formula C13H16FNOS and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-(cyclopentyloxymethyl)-2-fluorobenzenecarbothioamide.
| Compound Name | 3-(cyclopentyloxymethyl)-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107115985 |
| Molecular Formula | C13H16FNOS |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-(cyclopentyloxymethyl)-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cccc(COC2CCCC2)c1F |
| InChI | InChI=1S/C13H16FNOS/c14-12-9(4-3-7-11(12)13(15)17)8-16-10-5-1-2-6-10/h3-4,7,10H,1-2,5-6,8H2,(H2,15,17) |
| InChIKey | ZRNPOMSGWJUKON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|