C11H17N3O3S — CID 107116642
2-amino-N,N-dimethyl-3-(1,2-oxazolidin-2-yl)benzenesulfonamide (PubChem CID 107116642) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-3-(1,2-oxazolidin-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-3-(1,2-oxazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107116642 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-amino-N,N-dimethyl-3-(1,2-oxazolidin-2-yl)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(N2CCCO2)c1N |
| InChI | InChI=1S/C11H17N3O3S/c1-13(2)18(15,16)10-6-3-5-9(11(10)12)14-7-4-8-17-14/h3,5-6H,4,7-8,12H2,1-2H3 |
| InChIKey | DESOIENUDHXYNB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|