C21H36OSi — CID 10711669
[2-cyclohexylidene-2-[(2R,5R,6R,9S)-2,6-dimethyl-1-oxaspiro[4.4]non-3-en-9-yl]ethyl]-trimethylsilane (PubChem CID 10711669) has the molecular formula C21H36OSi and a molecular weight of 332.60 g/mol. Its IUPAC name is [2-cyclohexylidene-2-[(2R,5R,6R,9S)-2,6-dimethyl-1-oxaspiro[4.4]non-3-en-9-yl]ethyl]-trimethylsilane.
| Compound Name | [2-cyclohexylidene-2-[(2R,5R,6R,9S)-2,6-dimethyl-1-oxaspiro[4.4]non-3-en-9-yl]ethyl]-trimethylsilane |
|---|---|
| PubChem CID | 10711669 |
| Molecular Formula | C21H36OSi |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | [2-cyclohexylidene-2-[(2R,5R,6R,9S)-2,6-dimethyl-1-oxaspiro[4.4]non-3-en-9-yl]ethyl]-trimethylsilane |
| SMILES | C[C@@H]1C=C[C@]2(O1)[C@H](C)CC[C@H]2C(C[Si](C)(C)C)=C1CCCCC1 |
| InChI | InChI=1S/C21H36OSi/c1-16-11-12-20(21(16)14-13-17(2)22-21)19(15-23(3,4)5)18-9-7-6-8-10-18/h13-14,16-17,20H,6-12,15H2,1-5H3/t16-,17-,20+,21+/m1/s1 |
| InChIKey | DPBHRYPSHJJZMR-JYWFKMLOSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|