C11H14N4O3S2 — CID 107117315
2-amino-N,N-dimethyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenesulfonamide (PubChem CID 107117315) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107117315 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-amino-N,N-dimethyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenesulfonamide |
| SMILES | Cc1nnc(Sc2cccc(S(=O)(=O)N(C)C)c2N)o1 |
| InChI | InChI=1S/C11H14N4O3S2/c1-7-13-14-11(18-7)19-8-5-4-6-9(10(8)12)20(16,17)15(2)3/h4-6H,12H2,1-3H3 |
| InChIKey | NRWCKNYCYRJLMS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|