C12H17N5O2S2 — CID 107117343
2-amino-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 107117343) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is 2-amino-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-amino-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107117343 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-amino-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1nnc(Sc2cccc(S(=O)(=O)N(C)C)c2N)n1C |
| InChI | InChI=1S/C12H17N5O2S2/c1-8-14-15-12(17(8)4)20-9-6-5-7-10(11(9)13)21(18,19)16(2)3/h5-7H,13H2,1-4H3 |
| InChIKey | FYQXOPMKZWITPD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|