About 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile
3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile (PubChem CID 10711746) has the molecular formula C13H8F6N4
and a molecular weight of 334.22 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile |
| PubChem CID | 10711746 |
| Molecular Formula | C13H8F6N4 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile |
| SMILES | Cc1[nH]nc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C13H8F6N4/c1-6-10(5-20)11(23-22-6)21-9-3-7(12(14,15)16)2-8(4-9)13(17,18)19/h2-4H,1H3,(H2,21,22,23) |
| InChIKey | JYZNGTJKXSBKKJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile (CID 10711746) is 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile is Cc1[nH]nc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1C#N.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile?
The InChIKey is JYZNGTJKXSBKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F6N4/c1-6-10(5-20)11(23-22-6)21-9-3-7(12(14,15)16)2-8(4-9)13(17,18)19/h2-4H,1H3,(H2,21,22,23).
What are the key properties of 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile?
3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile has a molecular weight of 334.22 g/mol, XLogP of 4.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)anilino]-5-methyl-1H-pyrazole-4-carbonitrile is sourced from PubChem (CID 10711746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).