About (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid
(7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid (PubChem CID 10711792) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid.
Molecular Properties
| Compound Name | (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid |
| PubChem CID | 10711792 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1C=CC(=O)/C1=C/CCCCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h10,12-17,21H,2-9,11H2,1H3,(H,23,24)/b14-12+,18-10+/t16-,17-/m1/s1 |
| InChIKey | UMVMSQVYPRJODL-XERGIRIOSA-N |
| XLogP | 4.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid?
The IUPAC name of (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid (CID 10711792) is (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid.
What is the SMILES notation for (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid?
The canonical SMILES for (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid is CCCCC[C@@H](O)/C=C/[C@@H]1C=CC(=O)/C1=C/CCCCCC(=O)O.
What is the InChIKey of (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid?
The InChIKey is UMVMSQVYPRJODL-XERGIRIOSA-N. The full InChI is InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h10,12-17,21H,2-9,11H2,1H3,(H,23,24)/b14-12+,18-10+/t16-,17-/m1/s1.
What are the key properties of (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid?
(7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid has a molecular weight of 334.46 g/mol, XLogP of 4.20, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-7-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoic acid is sourced from PubChem (CID 10711792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).