C21H34O3 — CID 10711803
(1R,2E,6R,8R,11E,15R)-3-(2-methoxypropan-2-yl)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-diene (PubChem CID 10711803) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1R,2E,6R,8R,11E,15R)-3-(2-methoxypropan-2-yl)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-diene.
| Compound Name | (1R,2E,6R,8R,11E,15R)-3-(2-methoxypropan-2-yl)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-diene |
|---|---|
| PubChem CID | 10711803 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1R,2E,6R,8R,11E,15R)-3-(2-methoxypropan-2-yl)-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadeca-2,11-diene |
| SMILES | COC(C)(C)/C1=C/[C@H]2O[C@]2(C)CC/C=C(\C)CC[C@H]2O[C@]2(C)CC1 |
| InChI | InChI=1S/C21H34O3/c1-15-8-7-12-20(4)18(24-20)14-16(19(2,3)22-6)11-13-21(5)17(23-21)10-9-15/h8,14,17-18H,7,9-13H2,1-6H3/b15-8+,16-14+/t17-,18-,20-,21-/m1/s1 |
| InChIKey | MHCZPWKKJRTQEQ-MNDZULKHSA-N |
| XLogP | 4.95 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|