C20H34O2Si — CID 10711811
(3E,3aE)-3-[[tert-butyl(dimethyl)silyl]oxymethylidene]-5,5-dimethyl-1,2,6,7,9,9a-hexahydrocyclopenta[8]annulen-8-one (PubChem CID 10711811) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (3E,3aE)-3-[[tert-butyl(dimethyl)silyl]oxymethylidene]-5,5-dimethyl-1,2,6,7,9,9a-hexahydrocyclopenta[8]annulen-8-one.
| Compound Name | (3E,3aE)-3-[[tert-butyl(dimethyl)silyl]oxymethylidene]-5,5-dimethyl-1,2,6,7,9,9a-hexahydrocyclopenta[8]annulen-8-one |
|---|---|
| PubChem CID | 10711811 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (3E,3aE)-3-[[tert-butyl(dimethyl)silyl]oxymethylidene]-5,5-dimethyl-1,2,6,7,9,9a-hexahydrocyclopenta[8]annulen-8-one |
| SMILES | CC1(C)/C=C2C(=C/O[Si](C)(C)C(C)(C)C)/CCC/2CC(=O)CC1 |
| InChI | InChI=1S/C20H34O2Si/c1-19(2,3)23(6,7)22-14-16-9-8-15-12-17(21)10-11-20(4,5)13-18(15)16/h13-15H,8-12H2,1-7H3/b16-14+,18-13+ |
| InChIKey | JSQVWGQQMICJDO-LQIPXAKMSA-N |
| XLogP | 6.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|