C18H24O6 — CID 10711901
(1S,2S,7R,8S)-3,3,10,10-tetramethoxy-7,11-dimethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 10711901) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (1S,2S,7R,8S)-3,3,10,10-tetramethoxy-7,11-dimethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (1S,2S,7R,8S)-3,3,10,10-tetramethoxy-7,11-dimethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 10711901 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1S,2S,7R,8S)-3,3,10,10-tetramethoxy-7,11-dimethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | COC1(OC)C(=O)[C@H]2C=C(C)[C@@H]1[C@@H]1C(OC)(OC)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C18H24O6/c1-10-9-11-15(20)18(23-5,24-6)13(10)14-16(11,2)8-7-12(19)17(14,21-3)22-4/h7-9,11,13-14H,1-6H3/t11-,13-,14+,16-/m1/s1 |
| InChIKey | NWIQBCFDBDGLCB-OEYIWLLWSA-N |
| XLogP | 1.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|