C16H12FN3O — CID 107119193
3-[[5-(3-aminoprop-1-ynyl)-3-pyridinyl]oxymethyl]-2-fluorobenzonitrile (PubChem CID 107119193) has the molecular formula C16H12FN3O and a molecular weight of 281.29 g/mol. Its IUPAC name is 3-[[5-(3-aminoprop-1-ynyl)-3-pyridinyl]oxymethyl]-2-fluorobenzonitrile.
| Compound Name | 3-[[5-(3-aminoprop-1-ynyl)-3-pyridinyl]oxymethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107119193 |
| Molecular Formula | C16H12FN3O |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-[[5-(3-aminoprop-1-ynyl)-3-pyridinyl]oxymethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cccc(COc2cncc(C#CCN)c2)c1F |
| InChI | InChI=1S/C16H12FN3O/c17-16-13(8-19)4-1-5-14(16)11-21-15-7-12(3-2-6-18)9-20-10-15/h1,4-5,7,9-10H,6,11,18H2 |
| InChIKey | DEYKJPQFOSZOLI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|