C19H28O3S — CID 10711936
(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 10711936) has the molecular formula C19H28O3S and a molecular weight of 336.50 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 10711936 |
| Molecular Formula | C19H28O3S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C19H28O3S/c1-14(13-23(21,22)15-7-4-3-5-8-15)16-10-11-17-18(20)9-6-12-19(16,17)2/h3-5,7-8,14,16-18,20H,6,9-13H2,1-2H3/t14-,16-,17+,18+,19-/m1/s1 |
| InChIKey | ABCWTBVRNAKSES-GYFISPQKSA-N |
| XLogP | 3.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |