C14H18FNO2 — CID 107119511
3-[[cyclopropylmethyl(ethyl)amino]methyl]-2-fluorobenzoic acid (PubChem CID 107119511) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-[[cyclopropylmethyl(ethyl)amino]methyl]-2-fluorobenzoic acid.
| Compound Name | 3-[[cyclopropylmethyl(ethyl)amino]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 107119511 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[[cyclopropylmethyl(ethyl)amino]methyl]-2-fluorobenzoic acid |
| SMILES | CCN(Cc1cccc(C(=O)O)c1F)CC1CC1 |
| InChI | InChI=1S/C14H18FNO2/c1-2-16(8-10-6-7-10)9-11-4-3-5-12(13(11)15)14(17)18/h3-5,10H,2,6-9H2,1H3,(H,17,18) |
| InChIKey | LQFKRJNUXLUHIX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |