About 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile
3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile (PubChem CID 107119968) has the molecular formula C13H12FN3O2
and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile |
| PubChem CID | 107119968 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile |
| SMILES | CC1(C)C(=O)NC(=O)N1Cc1cccc(C#N)c1F |
| InChI | InChI=1S/C13H12FN3O2/c1-13(2)11(18)16-12(19)17(13)7-9-5-3-4-8(6-15)10(9)14/h3-5H,7H2,1-2H3,(H,16,18,19) |
| InChIKey | SWSQQPZXEUWFOI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile?
The IUPAC name of 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile (CID 107119968) is 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile.
What is the SMILES notation for 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile?
The canonical SMILES for 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile is CC1(C)C(=O)NC(=O)N1Cc1cccc(C#N)c1F.
What is the InChIKey of 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile?
The InChIKey is SWSQQPZXEUWFOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O2/c1-13(2)11(18)16-12(19)17(13)7-9-5-3-4-8(6-15)10(9)14/h3-5H,7H2,1-2H3,(H,16,18,19).
What are the key properties of 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile?
3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile has a molecular weight of 261.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile is sourced from PubChem (CID 107119968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).