C17H26O5Si — CID 10712070
ethyl (1R,2S,4S)-2,4-dihydroxy-5-methylidene-2-(2-trimethylsilylfuran-3-yl)cyclohexane-1-carboxylate (PubChem CID 10712070) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is ethyl (1R,2S,4S)-2,4-dihydroxy-5-methylidene-2-(2-trimethylsilylfuran-3-yl)cyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,4S)-2,4-dihydroxy-5-methylidene-2-(2-trimethylsilylfuran-3-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10712070 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | ethyl (1R,2S,4S)-2,4-dihydroxy-5-methylidene-2-(2-trimethylsilylfuran-3-yl)cyclohexane-1-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OCC)[C@](O)(c2ccoc2[Si](C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C17H26O5Si/c1-6-21-15(19)13-9-11(2)14(18)10-17(13,20)12-7-8-22-16(12)23(3,4)5/h7-8,13-14,18,20H,2,6,9-10H2,1,3-5H3/t13-,14-,17+/m0/s1 |
| InChIKey | OHXGULLZAUBNKB-GRDNDAEWSA-N |
| XLogP | 1.90 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|