C12H12F2N4O — CID 107120776
3-amino-2,5-difluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]benzamide (PubChem CID 107120776) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-amino-2,5-difluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]benzamide.
| Compound Name | 3-amino-2,5-difluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107120776 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-amino-2,5-difluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]benzamide |
| SMILES | Cc1[nH]ncc1CNC(=O)c1cc(F)cc(N)c1F |
| InChI | InChI=1S/C12H12F2N4O/c1-6-7(5-17-18-6)4-16-12(19)9-2-8(13)3-10(15)11(9)14/h2-3,5H,4,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | XTVHTJSWXYITQI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|