About 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline
2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 107122454) has the molecular formula C8H5F2N3O
and a molecular weight of 197.14 g/mol. Its IUPAC name is 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline.
Molecular Properties
| Compound Name | 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline |
| PubChem CID | 107122454 |
| Molecular Formula | C8H5F2N3O |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | Nc1cc(F)cc(-c2nnco2)c1F |
| InChI | InChI=1S/C8H5F2N3O/c9-4-1-5(7(10)6(11)2-4)8-13-12-3-14-8/h1-3H,11H2 |
| InChIKey | PAYFGAQJYWCROL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline?
The IUPAC name of 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline (CID 107122454) is 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline.
What is the SMILES notation for 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline?
The canonical SMILES for 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline is Nc1cc(F)cc(-c2nnco2)c1F.
What is the InChIKey of 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline?
The InChIKey is PAYFGAQJYWCROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2N3O/c9-4-1-5(7(10)6(11)2-4)8-13-12-3-14-8/h1-3H,11H2.
What are the key properties of 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline?
2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline has a molecular weight of 197.14 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-3-(1,3,4-oxadiazol-2-yl)aniline is sourced from PubChem (CID 107122454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).