C15H11F2NO3 — CID 107122498
1-(2,5-difluoro-3-nitrophenyl)-2-(3-methylphenyl)ethanone (PubChem CID 107122498) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is 1-(2,5-difluoro-3-nitrophenyl)-2-(3-methylphenyl)ethanone.
| Compound Name | 1-(2,5-difluoro-3-nitrophenyl)-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 107122498 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-(2,5-difluoro-3-nitrophenyl)-2-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(CC(=O)c2cc(F)cc([N+](=O)[O-])c2F)c1 |
| InChI | InChI=1S/C15H11F2NO3/c1-9-3-2-4-10(5-9)6-14(19)12-7-11(16)8-13(15(12)17)18(20)21/h2-5,7-8H,6H2,1H3 |
| InChIKey | MAMOVZHHGWYWTR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|