C19H22N2O4 — CID 10712328
2-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 10712328) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 10712328 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)propyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1CCCN1C(=O)C2=C(CCCC2)C1=O |
| InChI | InChI=1S/C19H22N2O4/c22-16-12-6-1-2-7-13(12)17(23)20(16)10-5-11-21-18(24)14-8-3-4-9-15(14)19(21)25/h1-11H2 |
| InChIKey | IEVWIKJHPWEDER-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|