C13H13F2N3O — CID 107123726
(3-amino-2,5-difluorophenyl)-(1-propylimidazol-2-yl)methanone (PubChem CID 107123726) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(1-propylimidazol-2-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(1-propylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 107123726 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(1-propylimidazol-2-yl)methanone |
| SMILES | CCCn1ccnc1C(=O)c1cc(F)cc(N)c1F |
| InChI | InChI=1S/C13H13F2N3O/c1-2-4-18-5-3-17-13(18)12(19)9-6-8(14)7-10(16)11(9)15/h3,5-7H,2,4,16H2,1H3 |
| InChIKey | TZPSGFKUVSRATL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|