About 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione
5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione (PubChem CID 107124200) has the molecular formula C6H4ClN3O2S
and a molecular weight of 217.64 g/mol. Its IUPAC name is 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione |
| PubChem CID | 107124200 |
| Molecular Formula | C6H4ClN3O2S |
| Molecular Weight | 217.64 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ncc(Cl)s2)N1 |
| InChI | InChI=1S/C6H4ClN3O2S/c7-2-1-8-5(13-2)3-4(11)10-6(12)9-3/h1,3H,(H2,9,10,11,12) |
| InChIKey | DXCOXCQAVZFOGO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.64 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
The IUPAC name of 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione (CID 107124200) is 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione is O=C1NC(=O)C(c2ncc(Cl)s2)N1.
What is the InChIKey of 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
The InChIKey is DXCOXCQAVZFOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3O2S/c7-2-1-8-5(13-2)3-4(11)10-6(12)9-3/h1,3H,(H2,9,10,11,12).
What are the key properties of 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione has a molecular weight of 217.64 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-1,3-thiazol-2-yl)imidazolidine-2,4-dione is sourced from PubChem (CID 107124200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).