About 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide
2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide (PubChem CID 107124245) has the molecular formula C11H9ClFN3OS
and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide.
Molecular Properties
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide |
| PubChem CID | 107124245 |
| Molecular Formula | C11H9ClFN3OS |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide |
| SMILES | NC(=O)C(Nc1cccc(F)c1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C11H9ClFN3OS/c12-8-5-15-11(18-8)9(10(14)17)16-7-3-1-2-6(13)4-7/h1-5,9,16H,(H2,14,17) |
| InChIKey | SYACAGFUKIKCRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide?
The IUPAC name of 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide (CID 107124245) is 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide.
What is the SMILES notation for 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide?
The canonical SMILES for 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide is NC(=O)C(Nc1cccc(F)c1)c1ncc(Cl)s1.
What is the InChIKey of 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide?
The InChIKey is SYACAGFUKIKCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClFN3OS/c12-8-5-15-11(18-8)9(10(14)17)16-7-3-1-2-6(13)4-7/h1-5,9,16H,(H2,14,17).
What are the key properties of 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide?
2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide has a molecular weight of 285.73 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluoroanilino)acetamide is sourced from PubChem (CID 107124245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).