C22H33NO2 — CID 10712429
10-butyl-3,3,6,6,9-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 10712429) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 10-butyl-3,3,6,6,9-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-butyl-3,3,6,6,9-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 10712429 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 10-butyl-3,3,6,6,9-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCCCN1C2=C(C(=O)CC(C)(C)C2)C(C)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C22H33NO2/c1-7-8-9-23-15-10-21(3,4)12-17(24)19(15)14(2)20-16(23)11-22(5,6)13-18(20)25/h14H,7-13H2,1-6H3 |
| InChIKey | YGWQQAXRIVSJNC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |