About 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol
2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol (PubChem CID 107124480) has the molecular formula C8H13ClN2OS
and a molecular weight of 220.73 g/mol. Its IUPAC name is 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol |
| PubChem CID | 107124480 |
| Molecular Formula | C8H13ClN2OS |
| Molecular Weight | 220.73 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol |
| SMILES | CC(C)C(N)C(O)c1ncc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2OS/c1-4(2)6(10)7(12)8-11-3-5(9)13-8/h3-4,6-7,12H,10H2,1-2H3 |
| InChIKey | FIPBEJKNRXKXMW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.73 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol?
The IUPAC name of 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol (CID 107124480) is 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol.
What is the SMILES notation for 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol?
The canonical SMILES for 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol is CC(C)C(N)C(O)c1ncc(Cl)s1.
What is the InChIKey of 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol?
The InChIKey is FIPBEJKNRXKXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2OS/c1-4(2)6(10)7(12)8-11-3-5(9)13-8/h3-4,6-7,12H,10H2,1-2H3.
What are the key properties of 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol?
2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol has a molecular weight of 220.73 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(5-chloro-1,3-thiazol-2-yl)-3-methylbutan-1-ol is sourced from PubChem (CID 107124480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).