C9H6Cl2IN3OS — CID 107124705
5-chloro-2-[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]-1,3-thiazole (PubChem CID 107124705) has the molecular formula C9H6Cl2IN3OS and a molecular weight of 402.04 g/mol. Its IUPAC name is 5-chloro-2-[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]-1,3-thiazole.
| Compound Name | 5-chloro-2-[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 107124705 |
| Molecular Formula | C9H6Cl2IN3OS |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 400.87 |
| IUPAC Name | 5-chloro-2-[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]-1,3-thiazole |
| SMILES | COCc1nc(-c2ncc(Cl)s2)nc(Cl)c1I |
| InChI | InChI=1S/C9H6Cl2IN3OS/c1-16-3-4-6(12)7(11)15-8(14-4)9-13-2-5(10)17-9/h2H,3H2,1H3 |
| InChIKey | OVIRCNIOYCQYTH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|